RonniI642520 RonniI642520
  • 25-10-2022
  • Mathematics
contestada

Evaluate cos 150° without using a calculator.Ο Α.√32B. 2O C. -1/2OD. -32

Evaluate cos 150 without using a calculatorΟ Α32B 2O C 12OD 32 class=

Respuesta :

RawlinS623290 RawlinS623290
  • 25-10-2022
Answer:

Explanation:

Note that:

[tex]\begin{gathered} cos(A+B)=cosAcosB-sinAsinB \\ cos(150^0)=cos(90+60) \end{gathered}[/tex]

Applying the addition formula given above to cos 150:

[tex]\begin{gathered} cos(150)=cos(90)cos(60)-sin(90)sin(60) \\ \\ cos(150)=0(\frac{1}{2})-1(\frac{\sqrt{3}}{2}) \\ \\ cos(150)=0-\frac{\sqrt{3}}{2} \\ \\ cos \end{gathered}[/tex]

Answer Link

Otras preguntas

what type of organism has the simplest level of organization
Which was the Confederacy's first ironclad vessel, built on the hull of the Union ship, USS Merrimack? a. Hunley b. Monitor c. Virginia d. Kearsarge
The trial of Peter Zenger is widely credited with being the first example of American freedom of __________, even though the American nation did not yet exist.
Which words make up the adverb phrase in this sentence? We built a giant snowman in the backyard yesterday afternoon. a. We built b. a giant snowman c. yesterd
True or false A military strategy of the North during the Civil War was a naval blockade of all Southern ports
Everyone played pretty well,but Jenny scored the winning basket simple or a compound
How much time would it take for an airplane to reach its destination if it traveled at an average speed of 790 km/hr for a distance of 4,700km? What is the airp
4.72n - 0.1 = 8 + 0.67n
what is 14.4 divided by 0.12
x over 2 (as a fraction) -8= 19 please solve the equation