zechgirl101 zechgirl101
  • 22-04-2022
  • Mathematics
contestada

What is the slope of the line 3 = 4 + 5?

Respuesta :

jsimpson11000 jsimpson11000
  • 22-04-2022

Answer:

4/3 = slope

Step-by-step explanation:

Answer Link

Otras preguntas

An unwritten rule of British cabinets is that even when individual ministers disagree with a given policy, they still must appear unified and take responsibilit
A triangle has side lengths of 15,20 and 25. What type of triangle is it?
The primary purpose of training is to ________. modify inappropriate behaviors offer feedback about job performance provide job-related knowledge and skills sup
A client visits the occupational health office of the factory in which he works. He has fallen asleep on the line and has a history of muscle weakness. This ins
If the current flowing through a circuit of constant resistance is doubled, the power dissipated by that circuit will
PLEASE HELP! WILL MARK BRAINLIEST!! 13 POINTS! There are two points on the circle A and B. Each point has a light which is switched on. Bob starts at the point
I need help with 9 and 10​
Give the IUPAC name of the given compound.(CH3)-CH(NH2)-CH3
2. Write the chemical equations for the neutralization reactions that occurred when HCL and NaOH were added to the buffer solution.
he Metamorphosis us told in the third person, but we are privy to what Gregor is thinking and feeling. How does this point of view affect the reader’s understan